cas: 425656-23-1 — see every product listed under this CAS number, including other names
3-Bromo-N-cyclopropyl-4-methoxybenzenesulfonamide, ≥95%, ≥95% (CAS 425656-23-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11402Q-100mg |
| cas | 425656-23-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 1370.00 Pln | |
| Chemat | 5g | 2613.20 Pln | |
| Chemat | 10g | 3851.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-N-cyclopropyl-4-methoxybenzenesulfonamide (CAS 425656-23-1) is a chemical compound with the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. IUPAC name: 3-bromo-N-cyclopropyl-4-methoxybenzenesulfonamide. InChIKey: FTBKUKITYFSDCQ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3S |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | 3-bromo-N-cyclopropyl-4-methoxybenzenesulfonamide |
| InChIKey | FTBKUKITYFSDCQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)NC2CC2)Br |
Computed by PubChem (NCBI)