Products 1001334-11-7
CAS 1001334-11-7 is the registry number for (3R)-1-(4-Bromobenzenesulfonyl)pyrrolidin-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3R)-1-(4-bromophenyl)sulfonylpyrrolidin-3-ol (CAS 1001334-11-7) is a chemical compound with the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. IUPAC name: (3R)-1-(4-bromophenyl)sulfonylpyrrolidin-3-ol. InChIKey: VVEPZEYUGIZNCS-SECBINFHSA-N.
| Molecular formula | C10H12BrNO3S |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | (3R)-1-(4-bromophenyl)sulfonylpyrrolidin-3-ol |
| InChIKey | VVEPZEYUGIZNCS-SECBINFHSA-N |
| SMILES | C1CN(C[C@@H]1O)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)