CAS 454-65-9 appears in our catalog under these names: 3-Bromobenzenesulfonyl fluoride, 95-<97%, 3-Bromobenzenesulfonyl fluoride, ≥97-<99%, 3–Bromobenzene–1–sulfonyl fluoride, 3-Bromobenzenesulfonyl fluoride, 3-Bromobenzene-1-sulfonyl fluoride, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Sigma-Aldrich, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 1g, 250mg.
3-bromobenzenesulfonyl fluoride (CAS 454-65-9) is a chemical compound with the molecular formula C6H4BrFO2S and a molecular weight of 239.06 g/mol. IUPAC name: 3-bromobenzenesulfonyl fluoride. InChIKey: LELPUBDFQNSHLE-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFO2S |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | 3-bromobenzenesulfonyl fluoride |
| InChIKey | LELPUBDFQNSHLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)S(=O)(=O)F |
Computed by PubChem (NCBI)