Products 1783412-57-6

CAS 1783412-57-6 is the registry number for Methyl 5-bromo-4-fluorothiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-bromo-4-fluorothiophene-3-carboxylate (CAS 1783412-57-6) is a chemical compound with the molecular formula C6H4BrFO2S and a molecular weight of 239.06 g/mol. IUPAC name: methyl 5-bromo-4-fluorothiophene-3-carboxylate. InChIKey: AYFFITPJIFIFNS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrFO2S
Molecular weight239.06 g/mol
IUPAC namemethyl 5-bromo-4-fluorothiophene-3-carboxylate
InChIKeyAYFFITPJIFIFNS-UHFFFAOYSA-N
SMILESCOC(=O)C1=CSC(=C1F)Br

Computed by PubChem (NCBI)