CAS 97511-04-1 appears in our catalog under these names: 3–Bromodibenzothiophene, 3-Bromodibenzothiophene, >98.0%(GC), 3-Bromodibenzothiophene, 98%, 98%, 3-Bromodibenzo[b,d]thiophene, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
3-bromodibenzothiophene (CAS 97511-04-1) is a chemical compound with the molecular formula C12H7BrS and a molecular weight of 263.15 g/mol. IUPAC name: 3-bromodibenzothiophene. InChIKey: FDPBPKDNWCZVQR-UHFFFAOYSA-N.
| Molecular formula | C12H7BrS |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | 3-bromodibenzothiophene |
| InChIKey | FDPBPKDNWCZVQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=C(C=C3)Br |
Computed by PubChem (NCBI)