cas: 886501-21-9 — see every product listed under this CAS number, including other names
3-Chloro-2,4-difluorobenzamide (CAS 886501-21-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F342447-5G |
| cas | 886501-21-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2486.64 Pln | |
| Fluorochem | 10g | 4183.96 Pln |
| delivery time | 3-4 weeks |
|---|
3-chloro-2,4-difluorobenzamide (CAS 886501-21-9) is a chemical compound with the molecular formula C7H4ClF2NO and a molecular weight of 191.56 g/mol. IUPAC name: 3-chloro-2,4-difluorobenzamide. InChIKey: QCFGVBOHFVXPDU-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO |
|---|---|
| Molecular weight | 191.56 g/mol |
| IUPAC name | 3-chloro-2,4-difluorobenzamide |
| InChIKey | QCFGVBOHFVXPDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)N)F)Cl)F |
Computed by PubChem (NCBI)