CAS 886500-36-3 appears in our catalog under these names: 4-Chloro-2,6-difluorobenzamide, 95%, 4-Chloro-2,6-difluorobenzamide, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
4-chloro-2,6-difluorobenzamide (CAS 886500-36-3) is a chemical compound with the molecular formula C7H4ClF2NO and a molecular weight of 191.56 g/mol. IUPAC name: 4-chloro-2,6-difluorobenzamide. InChIKey: WYCJKDFBALNGMP-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO |
|---|---|
| Molecular weight | 191.56 g/mol |
| IUPAC name | 4-chloro-2,6-difluorobenzamide |
| InChIKey | WYCJKDFBALNGMP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)N)F)Cl |
Computed by PubChem (NCBI)