cas: 1451391-17-5 — see every product listed under this CAS number, including other names
3-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol 98% (CAS 1451391-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A586433-100mg |
| cas | 1451391-17-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A586433 |
3-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1451391-17-5) is a chemical compound with the molecular formula C12H16BClO3 and a molecular weight of 254.52 g/mol. IUPAC name: 3-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: BSFCYZUEPAANES-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO3 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | 3-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | BSFCYZUEPAANES-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2Cl)O |
Computed by PubChem (NCBI)