CAS 779331-28-1 appears in our catalog under these names: (5-chloro-2-hydroxyphenyl)boronic acid pinacol ester, 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol 97%, 4-Chloro-2-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-yl)Phenol, 97%, 97%, (5-CHLORO-2-HYDROXYPHENYL)BORONIC ACID PINACOL ESTER, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g.
4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 779331-28-1) is a chemical compound with the molecular formula C12H16BClO3 and a molecular weight of 254.52 g/mol. IUPAC name: 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: FJCPWBJRPORWHV-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO3 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | FJCPWBJRPORWHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)