cas: 1383985-27-0 — see every product listed under this CAS number, including other names
3-Chloro-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 95%, 95% (CAS 1383985-27-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch134NQ5-100mg |
| cas | 1383985-27-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 1994.00 Pln | |
| Chemat | 5g | 5862.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-chloro-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1383985-27-0) is a chemical compound with the molecular formula C13H14BClFNO2 and a molecular weight of 281.52 g/mol. IUPAC name: 3-chloro-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: BNLYXHSDWPLKHK-UHFFFAOYSA-N.
| Molecular formula | C13H14BClFNO2 |
|---|---|
| Molecular weight | 281.52 g/mol |
| IUPAC name | 3-chloro-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | BNLYXHSDWPLKHK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)F)C#N |
Computed by PubChem (NCBI)