CAS 1218790-15-8 is the registry number for 3-Chloro-5-cyano-2-fluorophenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1218790-15-8) is a chemical compound with the molecular formula C13H14BClFNO2 and a molecular weight of 281.52 g/mol. IUPAC name: 3-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: RTOGPVMSCHKPTC-UHFFFAOYSA-N.
| Molecular formula | C13H14BClFNO2 |
|---|---|
| Molecular weight | 281.52 g/mol |
| IUPAC name | 3-chloro-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | RTOGPVMSCHKPTC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)Cl)C#N |
Computed by PubChem (NCBI)