3-Chloro-2-fluorobenzamide, 97%
cas: 104326-94-5 — see every product listed under this CAS number, including other names
3-Chloro-2-fluorobenzamide, 97% (CAS 104326-94-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F005615-1G |
| cas | 104326-94-5 |
| size | 1g |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 200.99 Pln | |
| Fluorochem | 25g | 607.10 Pln | |
| Fluorochem | 100g | 1825.42 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 898.81 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 414.80 Pln | |
| Chemat | 100g | 1259.60 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
3-chloro-2-fluorobenzamide (CAS 104326-94-5) is a chemical compound with the molecular formula C7H5ClFNO and a molecular weight of 173.57 g/mol. IUPAC name: 3-chloro-2-fluorobenzamide. InChIKey: KGTCFPJGIYHDRZ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO |
|---|---|
| Molecular weight | 173.57 g/mol |
| IUPAC name | 3-chloro-2-fluorobenzamide |
| InChIKey | KGTCFPJGIYHDRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)C(=O)N |
Computed by PubChem (NCBI)