CAS 683274-49-9 appears in our catalog under these names: 2-Chloro-3-fluorobenzamide, 95%, 2-Chloro-3-fluorobenzamide. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 2,5g, 250mg.
2-chloro-3-fluorobenzamide (CAS 683274-49-9) is a chemical compound with the molecular formula C7H5ClFNO and a molecular weight of 173.57 g/mol. IUPAC name: 2-chloro-3-fluorobenzamide. InChIKey: DNVHMQCMCUGHMJ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO |
|---|---|
| Molecular weight | 173.57 g/mol |
| IUPAC name | 2-chloro-3-fluorobenzamide |
| InChIKey | DNVHMQCMCUGHMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Cl)C(=O)N |
Computed by PubChem (NCBI)