cas: 1083168-91-5 — see every product listed under this CAS number, including other names
3-Chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98% (CAS 1083168-91-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241803-250MG |
| cas | 1083168-91-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1861.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1083168-91-5) is a chemical compound with the molecular formula C12H17BClNO3 and a molecular weight of 269.53 g/mol. IUPAC name: 3-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: ZHWIZWNYOSGXSR-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO3 |
|---|---|
| Molecular weight | 269.53 g/mol |
| IUPAC name | 3-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | ZHWIZWNYOSGXSR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OC)Cl |
Computed by PubChem (NCBI)