cas: 1073353-73-7 — see every product listed under this CAS number, including other names
3-Chloro-2-methoxypyridine-4-boronic acid, pinacol ester, 98%, 98% (CAS 1073353-73-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J83-250mg |
| cas | 1073353-73-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2118.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloro-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1073353-73-7) is a chemical compound with the molecular formula C12H17BClNO3 and a molecular weight of 269.53 g/mol. IUPAC name: 3-chloro-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: JYVZFQGNBUYGIH-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO3 |
|---|---|
| Molecular weight | 269.53 g/mol |
| IUPAC name | 3-chloro-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | JYVZFQGNBUYGIH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)OC)Cl |
Computed by PubChem (NCBI)