cas: 458532-90-6 — see every product listed under this CAS number, including other names
3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 98% (CAS 458532-90-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J8O-100mg |
| cas | 458532-90-6 |
| size | 100mg |
| availability | 42.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 25g | 3395.60 Pln | |
| Chemat | 10g | 1403.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 458532-90-6) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: VUWRRLUCWJCPMF-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | VUWRRLUCWJCPMF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2)Cl |
Computed by PubChem (NCBI)