CAS 452972-15-5 appears in our catalog under these names: 4-Chloropyridine-3-boronic acid, pinacol ester, 98%, 4-Chloropyridine-3-boronic acid pinacol ester hydrochloride, 98%, 4–Chloropyridine–3–boronic acid pinacol ester, 4-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%, 97%, 4-Chloropyridine-3-boronic acid pinacol ester, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 25g, 100g.
4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 452972-15-5) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: KTLJNRVZMVZXMR-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | KTLJNRVZMVZXMR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2)Cl |
Computed by PubChem (NCBI)