cas: 915070-52-9 — see every product listed under this CAS number, including other names
3-Chloro-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine 98% (CAS 915070-52-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A222170-100mg |
| cas | 915070-52-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1349.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A222170 |
3-chloro-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine (CAS 915070-52-9) is a chemical compound with the molecular formula C10H13BClNO2 and a molecular weight of 225.48 g/mol. IUPAC name: 3-chloro-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine. InChIKey: FZBSYLRGRQBBQS-UHFFFAOYSA-N.
| Molecular formula | C10H13BClNO2 |
|---|---|
| Molecular weight | 225.48 g/mol |
| IUPAC name | 3-chloro-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine |
| InChIKey | FZBSYLRGRQBBQS-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=NC=C2)Cl |
Computed by PubChem (NCBI)