CAS 350489-38-2 is the registry number for 2-Chloro-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
2-chloro-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine (CAS 350489-38-2) is a chemical compound with the molecular formula C10H13BClNO2 and a molecular weight of 225.48 g/mol. IUPAC name: 2-chloro-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine. InChIKey: PORXRXSPSQYVBP-UHFFFAOYSA-N.
| Molecular formula | C10H13BClNO2 |
|---|---|
| Molecular weight | 225.48 g/mol |
| IUPAC name | 2-chloro-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine |
| InChIKey | PORXRXSPSQYVBP-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)