3-Chloro-4-hydroxybenzoic acid, 98%
cas: 3964-58-7 — see every product listed under this CAS number, including other names
3-Chloro-4-hydroxybenzoic acid, 98% (CAS 3964-58-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 75g, 100g, 500g, 1kg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch118946-5g |
| cas | 3964-58-7 |
| size | 5g |
| availability | 12000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 50g | 198.80 Pln | |
| Chemat | 75g | 261.20 Pln | |
| Chemat | 100g | 304.40 Pln | |
| Chemat | 500g | 1219.20 Pln | |
| Chemat | 1kg | 2032.40 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 200.99 Pln | |
| Fluorochem | 100g | 497.76 Pln | |
| Fluorochem | 500g | 1955.58 Pln | |
| Fluorochem | 1kg | 3527.94 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-hydroxybenzoic acid (CAS 3964-58-7) is a chemical compound with the molecular formula C7H5ClO3 and a molecular weight of 172.56 g/mol. IUPAC name: 3-chloro-4-hydroxybenzoic acid. InChIKey: QGNLHMKIGMZKJX-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO3 |
|---|---|
| Molecular weight | 172.56 g/mol |
| IUPAC name | 3-chloro-4-hydroxybenzoic acid |
| InChIKey | QGNLHMKIGMZKJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)O |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-4-hydroxybenzoate, Benzoic acid, 3-chloro-4-hydroxy-, 4-hydroxy-3-chlorobenzoic acid, 3-chloro-4-hydroxy-benzoic acid, 3-chloro-4-hydroxy benzoic acid, 3-chloro-4hydroxybenzoic acid, 3-chloro4-hydroxybenzoic acid, M-CHLORO-P-HYDROXYBENZOIC ACID, InChI=1/C7H5ClO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,(H,10,11