cas: 141738-80-9 — see every product listed under this CAS number, including other names
3-Chloro-4-iodobenzotrifluoride, 97% (CAS 141738-80-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004483-5G |
| cas | 141738-80-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 851.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-1-iodo-4-(trifluoromethyl)benzene (CAS 141738-80-9) is a chemical compound with the molecular formula C7H3ClF3I and a molecular weight of 306.45 g/mol. IUPAC name: 2-chloro-1-iodo-4-(trifluoromethyl)benzene. InChIKey: ULJRBVGSKAKZKQ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3I |
|---|---|
| Molecular weight | 306.45 g/mol |
| IUPAC name | 2-chloro-1-iodo-4-(trifluoromethyl)benzene |
| InChIKey | ULJRBVGSKAKZKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)I |
Computed by PubChem (NCBI)