CAS 873840-42-7 is the registry number for 4-Chloro-2-iodobenzotrifluoride, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
4-chloro-2-iodo-1-(trifluoromethyl)benzene (CAS 873840-42-7) is a chemical compound with the molecular formula C7H3ClF3I and a molecular weight of 306.45 g/mol. IUPAC name: 4-chloro-2-iodo-1-(trifluoromethyl)benzene. InChIKey: JVKIDYOAEIQDFD-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3I |
|---|---|
| Molecular weight | 306.45 g/mol |
| IUPAC name | 4-chloro-2-iodo-1-(trifluoromethyl)benzene |
| InChIKey | JVKIDYOAEIQDFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)I)C(F)(F)F |
Computed by PubChem (NCBI)