3-Chloro-4-nitro-1H-pyrazole, 97%
cas: 35852-75-6 — see every product listed under this CAS number, including other names
3-Chloro-4-nitro-1H-pyrazole, 97% (CAS 35852-75-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: AmBeed, Chemat, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A564321-10g |
| cas | 35852-75-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12093.97 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 500mg | 736.40 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 3664.40 Pln | |
| Chemat | 25g | 15208.40 Pln | |
| Fluorochem | 100mg | 617.51 Pln | |
| Fluorochem | 250mg | 961.14 Pln | |
| Fluorochem | 500mg | 1669.22 Pln | |
| Fluorochem | 1g | 2356.48 Pln | |
| Fluorochem | 5g | 8234.62 Pln | |
| Fluorochem | 10g | 13930.53 Pln | |
| Fluorochem | 25g | 27795.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-4-nitro-1H-pyrazole (CAS 35852-75-6) is a chemical compound with the molecular formula C3H2ClN3O2 and a molecular weight of 147.52 g/mol. IUPAC name: 5-chloro-4-nitro-1H-pyrazole. InChIKey: GWCLPNSISWCBJD-UHFFFAOYSA-N.
| Molecular formula | C3H2ClN3O2 |
|---|---|
| Molecular weight | 147.52 g/mol |
| IUPAC name | 5-chloro-4-nitro-1H-pyrazole |
| InChIKey | GWCLPNSISWCBJD-UHFFFAOYSA-N |
| SMILES | C1=NNC(=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)