CAS 1369959-12-5 appears in our catalog under these names: 3–Chloro–5–nitro–1H–pyrazole, 3-Chloro-5-nitro-1H-pyrazole 97%, 3-Chloro-5-nitro-1H-pyrazole, 97%, 3-chloro-5-nitro-1H-pyrazole, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-chloro-5-nitro-1H-pyrazole (CAS 1369959-12-5) is a chemical compound with the molecular formula C3H2ClN3O2 and a molecular weight of 147.52 g/mol. IUPAC name: 3-chloro-5-nitro-1H-pyrazole. InChIKey: IAPLHVWLDQZZOU-UHFFFAOYSA-N.
| Molecular formula | C3H2ClN3O2 |
|---|---|
| Molecular weight | 147.52 g/mol |
| IUPAC name | 3-chloro-5-nitro-1H-pyrazole |
| InChIKey | IAPLHVWLDQZZOU-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)