cas: 2096335-18-9 — see every product listed under this CAS number, including other names
3-Chloro-5-fluoro-4-isopropoxyphenylboronic acid, 95% (CAS 2096335-18-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623098-250MG |
| cas | 2096335-18-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1174.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3-chloro-5-fluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 2096335-18-9) is a chemical compound with the molecular formula C9H11BClFO3 and a molecular weight of 232.44 g/mol. IUPAC name: (3-chloro-5-fluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: FFHISCUVPDXONS-UHFFFAOYSA-N.
| Molecular formula | C9H11BClFO3 |
|---|---|
| Molecular weight | 232.44 g/mol |
| IUPAC name | (3-chloro-5-fluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | FFHISCUVPDXONS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)