CAS 2096339-37-4 is the registry number for 5-Chloro-2-fluoro-3-isopropoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
(5-chloro-2-fluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 2096339-37-4) is a chemical compound with the molecular formula C9H11BClFO3 and a molecular weight of 232.44 g/mol. IUPAC name: (5-chloro-2-fluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: BMPKFAWGRCUCJE-UHFFFAOYSA-N.
| Molecular formula | C9H11BClFO3 |
|---|---|
| Molecular weight | 232.44 g/mol |
| IUPAC name | (5-chloro-2-fluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | BMPKFAWGRCUCJE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)OC(C)C)Cl)(O)O |
Computed by PubChem (NCBI)