cas: 1005764-23-7 — see every product listed under this CAS number, including other names
3-Chloro-5-fluorobenzotrifluoride (CAS 1005764-23-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F062705-1G |
| cas | 1005764-23-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1320.39 Pln | |
| Fluorochem | 5g | 3809.09 Pln |
| delivery time | 2-3 weeks |
|---|
1-chloro-3-fluoro-5-(trifluoromethyl)benzene (CAS 1005764-23-7) is a chemical compound with the molecular formula C7H3ClF4 and a molecular weight of 198.54 g/mol. IUPAC name: 1-chloro-3-fluoro-5-(trifluoromethyl)benzene. InChIKey: KLZMNQRDDPSCLS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4 |
|---|---|
| Molecular weight | 198.54 g/mol |
| IUPAC name | 1-chloro-3-fluoro-5-(trifluoromethyl)benzene |
| InChIKey | KLZMNQRDDPSCLS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)