CAS 1005764-23-7 appears in our catalog under these names: 3-Chloro-5-fluorobenzotrifluoride, 95%, 3-Chloro-5-fluorobenzotrifluoride, ≥95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1-chloro-3-fluoro-5-(trifluoromethyl)benzene (CAS 1005764-23-7) is a chemical compound with the molecular formula C7H3ClF4 and a molecular weight of 198.54 g/mol. IUPAC name: 1-chloro-3-fluoro-5-(trifluoromethyl)benzene. InChIKey: KLZMNQRDDPSCLS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4 |
|---|---|
| Molecular weight | 198.54 g/mol |
| IUPAC name | 1-chloro-3-fluoro-5-(trifluoromethyl)benzene |
| InChIKey | KLZMNQRDDPSCLS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)