3-Chloro-5-methoxy-1-methyl-1H-indazole, 95%
cas: 1446410-04-3 — see every product listed under this CAS number, including other names
3-Chloro-5-methoxy-1-methyl-1H-indazole, 95% (CAS 1446410-04-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A217800-250mg |
| cas | 1446410-04-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 1032.31 Pln | |
| Ambeed | 5g | 2829.00 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 1108.52 Pln | |
| BLDpharm | 5g | 3041.18 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1139.60 Pln | |
| Chemat | 5g | 3822.80 Pln | |
| Fluorochem | 100mg | 508.17 Pln | |
| Fluorochem | 250mg | 836.18 Pln | |
| Fluorochem | 1g | 2111.77 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-chloro-5-methoxy-1-methylindazole (CAS 1446410-04-3) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 3-chloro-5-methoxy-1-methylindazole. InChIKey: NHDJJXRJCZFDSG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 3-chloro-5-methoxy-1-methylindazole |
| InChIKey | NHDJJXRJCZFDSG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)OC)C(=N1)Cl |
Computed by PubChem (NCBI)