Products 80484-00-0
CAS 80484-00-0 is the registry number for 6-Chloro-1-methyl-3,4-dihydroquinoxalin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-chloro-1-methyl-3,4-dihydroquinoxalin-2-one (CAS 80484-00-0) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 6-chloro-1-methyl-3,4-dihydroquinoxalin-2-one. InChIKey: KCCDAWOBCMZDBX-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 6-chloro-1-methyl-3,4-dihydroquinoxalin-2-one |
| InChIKey | KCCDAWOBCMZDBX-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CNC2=C1C=CC(=C2)Cl |
Computed by PubChem (NCBI)