cas: 76241-79-7 — see every product listed under this CAS number, including other names
3-Chlorophthalonitrile, 97%+,RG, 97%+,RG (CAS 76241-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116822-100mg |
| cas | 76241-79-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 1629.20 Pln | |
| Chemat | 25g | 7576.40 Pln |
| purity | 97%+,RG |
|---|---|
| delivery time | 3 weeks |
3-chlorobenzene-1,2-dicarbonitrile (CAS 76241-79-7) is a chemical compound with the molecular formula C8H3ClN2 and a molecular weight of 162.57 g/mol. IUPAC name: 3-chlorobenzene-1,2-dicarbonitrile. InChIKey: LZQGFZMYLYXXHI-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2 |
|---|---|
| Molecular weight | 162.57 g/mol |
| IUPAC name | 3-chlorobenzene-1,2-dicarbonitrile |
| InChIKey | LZQGFZMYLYXXHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C#N)C#N |
Computed by PubChem (NCBI)