cas: 76241-79-7 — see every product listed under this CAS number, including other names
3-Chlorophthalonitrile, 98% (CAS 76241-79-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A198818-10g |
| cas | 76241-79-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6202.42 Pln | |
| AmBeed | 25g | 10902.64 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chlorobenzene-1,2-dicarbonitrile (CAS 76241-79-7) is a chemical compound with the molecular formula C8H3ClN2 and a molecular weight of 162.57 g/mol. IUPAC name: 3-chlorobenzene-1,2-dicarbonitrile. InChIKey: LZQGFZMYLYXXHI-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2 |
|---|---|
| Molecular weight | 162.57 g/mol |
| IUPAC name | 3-chlorobenzene-1,2-dicarbonitrile |
| InChIKey | LZQGFZMYLYXXHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C#N)C#N |
Computed by PubChem (NCBI)