cas: 14906-64-0 — see every product listed under this CAS number, including other names
3-Cyanopyridine N-Oxide, 98.0%, 98.0% (CAS 14906-64-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112LDL-1g |
| cas | 14906-64-0 |
| size | 1g |
| availability | 93g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 25g | 818.00 Pln | |
| Chemat | 10g | 390.80 Pln | |
| Chemat | 50g | 1442.00 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
1-oxidopyridin-1-ium-3-carbonitrile (CAS 14906-64-0) is a chemical compound with the molecular formula C6H4N2O and a molecular weight of 120.11 g/mol. IUPAC name: 1-oxidopyridin-1-ium-3-carbonitrile. InChIKey: WOOVSQCALYYUDO-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O |
|---|---|
| Molecular weight | 120.11 g/mol |
| IUPAC name | 1-oxidopyridin-1-ium-3-carbonitrile |
| InChIKey | WOOVSQCALYYUDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])C#N |
Computed by PubChem (NCBI)