Nicotinonitrile-1-oxide 95+%
cas: 14906-64-0 — see every product listed under this CAS number, including other names
Nicotinonitrile-1-oxide 95+% (CAS 14906-64-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A245763-100mg |
| cas | 14906-64-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1366.06 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A245763 |
1-oxidopyridin-1-ium-3-carbonitrile (CAS 14906-64-0) is a chemical compound with the molecular formula C6H4N2O and a molecular weight of 120.11 g/mol. IUPAC name: 1-oxidopyridin-1-ium-3-carbonitrile. InChIKey: WOOVSQCALYYUDO-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O |
|---|---|
| Molecular weight | 120.11 g/mol |
| IUPAC name | 1-oxidopyridin-1-ium-3-carbonitrile |
| InChIKey | WOOVSQCALYYUDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])C#N |
Computed by PubChem (NCBI)