cas: 1247187-59-2 — see every product listed under this CAS number, including other names
3-Cyclohexyl-4-nitro-1h-pyrazole, 97% (CAS 1247187-59-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1225106-10g |
| cas | 1247187-59-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 9633.19 Pln | |
| AmBeed | 25g | 19111.75 Pln | |
| AmBeed | 250mg | 1358.98 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-cyclohexyl-4-nitro-1H-pyrazole (CAS 1247187-59-2) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: 5-cyclohexyl-4-nitro-1H-pyrazole. InChIKey: SJYQTFKYTJTYOU-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-cyclohexyl-4-nitro-1H-pyrazole |
| InChIKey | SJYQTFKYTJTYOU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(C=NN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)