cas: 1247187-59-2 — see every product listed under this CAS number, including other names
5-cyclohexyl-4-nitro-1H-pyrazole, 97% (CAS 1247187-59-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F719265-1G |
| cas | 1247187-59-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1091.30 Pln | |
| Fluorochem | 5g | 3127.04 Pln | |
| Fluorochem | 10g | 5152.37 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-cyclohexyl-4-nitro-1H-pyrazole (CAS 1247187-59-2) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: 5-cyclohexyl-4-nitro-1H-pyrazole. InChIKey: SJYQTFKYTJTYOU-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-cyclohexyl-4-nitro-1H-pyrazole |
| InChIKey | SJYQTFKYTJTYOU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(C=NN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)