cas: 1243471-01-3 — see every product listed under this CAS number, including other names
3-Cyclopropoxy-5-(trifluoromethyl)aniline, ≥95%, ≥95% (CAS 1243471-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111LWD-100mg |
| cas | 1243471-01-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1173.20 Pln | |
| Chemat | 1g | 5229.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-cyclopropyloxy-5-(trifluoromethyl)aniline (CAS 1243471-01-3) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 3-cyclopropyloxy-5-(trifluoromethyl)aniline. InChIKey: XQQNTPUDLNYGEL-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 3-cyclopropyloxy-5-(trifluoromethyl)aniline |
| InChIKey | XQQNTPUDLNYGEL-UHFFFAOYSA-N |
| SMILES | C1CC1OC2=CC(=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)