cas: 3119-93-5 — see every product listed under this CAS number, including other names
3-Ethyl-2-methylbenzo[d]thiazol-3-ium iodide, 98% (CAS 3119-93-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624405-1G |
| cas | 3119-93-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 25g | 778.91 Pln | |
| Fluorochem | 100g | 2825.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide (CAS 3119-93-5) is a chemical compound with the molecular formula C10H12INS and a molecular weight of 305.18 g/mol. IUPAC name: 3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide. InChIKey: HWFCSPDBFXYFKY-UHFFFAOYSA-M.
| Molecular formula | C10H12INS |
|---|---|
| Molecular weight | 305.18 g/mol |
| IUPAC name | 3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide |
| InChIKey | HWFCSPDBFXYFKY-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C(SC2=CC=CC=C21)C.[I-] |
Computed by PubChem (NCBI)