cas: 3119-93-5 — see every product listed under this CAS number, including other names
3-Ethyl-2-methylbenzothiazolium Iodide, >98.0%(HPLC)(T) (CAS 3119-93-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E0476-5G |
| cas | 3119-93-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 241.28 Pln | |
| TCI | 25g | 728.08 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide (CAS 3119-93-5) is a chemical compound with the molecular formula C10H12INS and a molecular weight of 305.18 g/mol. IUPAC name: 3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide. InChIKey: HWFCSPDBFXYFKY-UHFFFAOYSA-M.
| Molecular formula | C10H12INS |
|---|---|
| Molecular weight | 305.18 g/mol |
| IUPAC name | 3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide |
| InChIKey | HWFCSPDBFXYFKY-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C(SC2=CC=CC=C21)C.[I-] |
Computed by PubChem (NCBI)