cas: 132196-66-8 — see every product listed under this CAS number, including other names
3-Ethynylperylene, 95% (CAS 132196-66-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1186848-25mg |
| cas | 132196-66-8 |
| size | 25mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 364.81 Pln | |
| Ambeed | 100mg | 871.00 Pln | |
| Ambeed | 250mg | 1855.56 Pln | |
| Ambeed | 1g | 6211.00 Pln | |
| BLDpharm | 25mg | 392.11 Pln | |
| BLDpharm | 50mg | 597.59 Pln | |
| BLDpharm | 100mg | 930.81 Pln | |
| BLDpharm | 250mg | 1991.55 Pln | |
| BLDpharm | 1g | 6689.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-ethynylperylene (CAS 132196-66-8) is a chemical compound with the molecular formula C22H12 and a molecular weight of 276.3 g/mol. IUPAC name: 3-ethynylperylene. InChIKey: VOVKFLKDPQAQIR-UHFFFAOYSA-N.
| Molecular formula | C22H12 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 3-ethynylperylene |
| InChIKey | VOVKFLKDPQAQIR-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C=CC=C3C2=C(C=C1)C4=CC=CC5=C4C3=CC=C5 |
Computed by PubChem (NCBI)