CAS 132196-66-8 appears in our catalog under these names: 3-Ethynyl perylene, 95%, 3–Ethynyl perylene, Perylene, 3-ethynyl-, 95%, 95%, 3-Ethynylperylene, 3-Ethynylperylene, 95%. Offered by: Lumiprobe, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 50mg, 100mg, 25mg, 250mg, 1g, Get quote.
3-ethynylperylene (CAS 132196-66-8) is a chemical compound with the molecular formula C22H12 and a molecular weight of 276.3 g/mol. IUPAC name: 3-ethynylperylene. InChIKey: VOVKFLKDPQAQIR-UHFFFAOYSA-N.
| Molecular formula | C22H12 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 3-ethynylperylene |
| InChIKey | VOVKFLKDPQAQIR-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C=CC=C3C2=C(C=C1)C4=CC=CC5=C4C3=CC=C5 |
Computed by PubChem (NCBI)