CAS 1261941-44-9 appears in our catalog under these names: 3-Fluoro-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%, 95%, 3-Fluoro-1,1'-biphenyl-4,4'-dicarboxylic acid, 97%, 3-Fluoro-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(4-carboxyphenyl)-2-fluorobenzoic acid (CAS 1261941-44-9) is a chemical compound with the molecular formula C14H9FO4 and a molecular weight of 260.22 g/mol. IUPAC name: 4-(4-carboxyphenyl)-2-fluorobenzoic acid. InChIKey: SSFBQFMLVDXIHE-UHFFFAOYSA-N.
| Molecular formula | C14H9FO4 |
|---|---|
| Molecular weight | 260.22 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)-2-fluorobenzoic acid |
| InChIKey | SSFBQFMLVDXIHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C(=O)O)F)C(=O)O |
Computed by PubChem (NCBI)