Products 1261893-62-2
CAS 1261893-62-2 is the registry number for 2-(4-Carboxy-3-fluorophenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(2-carboxyphenyl)-2-fluorobenzoic acid (CAS 1261893-62-2) is a chemical compound with the molecular formula C14H9FO4 and a molecular weight of 260.22 g/mol. IUPAC name: 4-(2-carboxyphenyl)-2-fluorobenzoic acid. InChIKey: YNOGECZNEPCVQJ-UHFFFAOYSA-N.
| Molecular formula | C14H9FO4 |
|---|---|
| Molecular weight | 260.22 g/mol |
| IUPAC name | 4-(2-carboxyphenyl)-2-fluorobenzoic acid |
| InChIKey | YNOGECZNEPCVQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)C(=O)O)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3'-Fluoro-[1,1'-biphenyl]-2,4'-dicarboxylic acid, 4-(2-carboxyphenyl)-2-fluorobenzoic acid, 3/'-Fluoro-[1,1/'-biphenyl]-2,4/'-dicarboxylic acid, [1,1'-Biphenyl]-2,4'-dicarboxylic acid, 3'-fluoro-, 3'-Fluoro-[1,1'-biphenyl]-2,4'-dicarboxylicacid, 4-(2-carboxyphenyl)-2-fluoro-benzoic acid, 3'-Fluoro[1,1'-biphenyl]-2,4'-dicarboxylic acid