cas: 2367-22-8 — see every product listed under this CAS number, including other names
3-Fluoro-1,1'-biphenyl 95% (CAS 2367-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A609091-1g |
| cas | 2367-22-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 620.69 Pln | |
| Ambeed | 25g | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A609091 |
1-fluoro-3-phenylbenzene (CAS 2367-22-8) is a chemical compound with the molecular formula C12H9F and a molecular weight of 172.20 g/mol. IUPAC name: 1-fluoro-3-phenylbenzene. InChIKey: MRCAAFFMZODJBP-UHFFFAOYSA-N.
| Molecular formula | C12H9F |
|---|---|
| Molecular weight | 172.20 g/mol |
| IUPAC name | 1-fluoro-3-phenylbenzene |
| InChIKey | MRCAAFFMZODJBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)