CAS 2367-22-8 appears in our catalog under these names: 3-Fluorobiphenyl, 95%, 3-Fluoro-1,1'-biphenyl 95%, 3-Fluoro-1,1'-biphenyl, 95%, 95%, 3-Fluoro-1,1'-biphenyl. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
1-fluoro-3-phenylbenzene (CAS 2367-22-8) is a chemical compound with the molecular formula C12H9F and a molecular weight of 172.20 g/mol. IUPAC name: 1-fluoro-3-phenylbenzene. InChIKey: MRCAAFFMZODJBP-UHFFFAOYSA-N.
| Molecular formula | C12H9F |
|---|---|
| Molecular weight | 172.20 g/mol |
| IUPAC name | 1-fluoro-3-phenylbenzene |
| InChIKey | MRCAAFFMZODJBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)