CAS 248270-25-9 appears in our catalog under these names: 3–Fluoro–4–formylphenylboronic acid, 3-Fluoro-4-formylbenzeneboronic acid, 98% , 3-Fluoro-4-formylphenylboronic Acid (contains varying amounts of Anhydride), 3-Fluoro-4-formylphenylboronic acid, 98%, 98%, 3-Fluoro-4-formylphenylboronic acid, 99.86%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, MedChemExpress. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 10 g, 5 g.
(3-fluoro-4-formylphenyl)boronic acid (CAS 248270-25-9) is a chemical compound with the molecular formula C7H6BFO3 and a molecular weight of 167.93 g/mol. IUPAC name: (3-fluoro-4-formylphenyl)boronic acid. InChIKey: NZNRMUVHUVCIBR-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO3 |
|---|---|
| Molecular weight | 167.93 g/mol |
| IUPAC name | (3-fluoro-4-formylphenyl)boronic acid |
| InChIKey | NZNRMUVHUVCIBR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C=O)F)(O)O |
Computed by PubChem (NCBI)