cas: 3556-52-3 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitrobenzamide, 95%, 95% (CAS 3556-52-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7WD-250mg |
| cas | 3556-52-3 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 789.20 Pln | |
| Chemat | 1g | 1696.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-4-nitrobenzamide (CAS 3556-52-3) is a chemical compound with the molecular formula C7H5FN2O3 and a molecular weight of 184.12 g/mol. IUPAC name: 3-fluoro-4-nitrobenzamide. InChIKey: CKHYKLBLOPFXTB-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O3 |
|---|---|
| Molecular weight | 184.12 g/mol |
| IUPAC name | 3-fluoro-4-nitrobenzamide |
| InChIKey | CKHYKLBLOPFXTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)