CAS 1208075-03-9 appears in our catalog under these names: 3-Fluoro-5-nitrobenzamide, 98%, 3-Fluoro-5-nitrobenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
3-fluoro-5-nitrobenzamide (CAS 1208075-03-9) is a chemical compound with the molecular formula C7H5FN2O3 and a molecular weight of 184.12 g/mol. IUPAC name: 3-fluoro-5-nitrobenzamide. InChIKey: QIQDJNUUWYCZFZ-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O3 |
|---|---|
| Molecular weight | 184.12 g/mol |
| IUPAC name | 3-fluoro-5-nitrobenzamide |
| InChIKey | QIQDJNUUWYCZFZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])F)C(=O)N |
Computed by PubChem (NCBI)