cas: 769-54-0 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitropyridine 1-oxide, 99%, 99% (CAS 769-54-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JGG-500mg |
| cas | 769-54-0 |
| size | 500mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 112.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 510.80 Pln | |
| Chemat | 100g | 1442.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-4-nitro-1-oxidopyridin-1-ium (CAS 769-54-0) is a chemical compound with the molecular formula C5H3FN2O3 and a molecular weight of 158.09 g/mol. IUPAC name: 3-fluoro-4-nitro-1-oxidopyridin-1-ium. InChIKey: QHWIGULJOZAPAQ-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O3 |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | 3-fluoro-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | QHWIGULJOZAPAQ-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC(=C1[N+](=O)[O-])F)[O-] |
Computed by PubChem (NCBI)