cas: 769-54-0 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitropyridine-N-oxide 98% (CAS 769-54-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182137-1g |
| cas | 769-54-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 431.56 Pln | |
| Ambeed | 25g | 620.69 Pln | |
| Ambeed | 100g | 1927.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A182137 |
3-fluoro-4-nitro-1-oxidopyridin-1-ium (CAS 769-54-0) is a chemical compound with the molecular formula C5H3FN2O3 and a molecular weight of 158.09 g/mol. IUPAC name: 3-fluoro-4-nitro-1-oxidopyridin-1-ium. InChIKey: QHWIGULJOZAPAQ-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O3 |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | 3-fluoro-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | QHWIGULJOZAPAQ-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC(=C1[N+](=O)[O-])F)[O-] |
Computed by PubChem (NCBI)